Products 1050477-39-8

CAS 1050477-39-8 is the registry number for Finerenone Impurity 17. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-cyanoethyl 2-[(4-cyano-2-methoxyphenyl)methylidene]-3-oxobutanoate (CAS 1050477-39-8) is a chemical compound with the molecular formula C16H14N2O4 and a molecular weight of 298.29 g/mol. IUPAC name: 2-cyanoethyl 2-[(4-cyano-2-methoxyphenyl)methylidene]-3-oxobutanoate. InChIKey: RFJLQSVKIAMLCX-UHFFFAOYSA-N.

Identity
Molecular formulaC16H14N2O4
Molecular weight298.29 g/mol
IUPAC name2-cyanoethyl 2-[(4-cyano-2-methoxyphenyl)methylidene]-3-oxobutanoate
InChIKeyRFJLQSVKIAMLCX-UHFFFAOYSA-N
SMILESCC(=O)C(=CC1=C(C=C(C=C1)C#N)OC)C(=O)OCCC#N

Computed by PubChem (NCBI)