Products 19336-92-6

CAS 19336-92-6 is the registry number for 2-((4-Acetamidophenyl)carbamoyl)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-[(4-acetamidophenyl)carbamoyl]benzoic acid (CAS 19336-92-6) is a chemical compound with the molecular formula C16H14N2O4 and a molecular weight of 298.29 g/mol. IUPAC name: 2-[(4-acetamidophenyl)carbamoyl]benzoic acid. InChIKey: IAJHYWAWKCNHQX-UHFFFAOYSA-N.

Identity
Molecular formulaC16H14N2O4
Molecular weight298.29 g/mol
IUPAC name2-[(4-acetamidophenyl)carbamoyl]benzoic acid
InChIKeyIAJHYWAWKCNHQX-UHFFFAOYSA-N
SMILESCC(=O)NC1=CC=C(C=C1)NC(=O)C2=CC=CC=C2C(=O)O

Computed by PubChem (NCBI)