Products 1449001-34-6
CAS 1449001-34-6 appears in our catalog under these names: 2-Methyl-4-phenoxyphenylboronic acid, 98%, 98%, (2-Methyl-4-phenoxyphenyl)boronic acid, 98%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
(2-methyl-4-phenoxyphenyl)boronic acid (CAS 1449001-34-6) is a chemical compound with the molecular formula C13H13BO3 and a molecular weight of 228.05 g/mol. IUPAC name: (2-methyl-4-phenoxyphenyl)boronic acid. InChIKey: ONABHGKRELKYRF-UHFFFAOYSA-N.
| Molecular formula | C13H13BO3 |
|---|---|
| Molecular weight | 228.05 g/mol |
| IUPAC name | (2-methyl-4-phenoxyphenyl)boronic acid |
| InChIKey | ONABHGKRELKYRF-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)OC2=CC=CC=C2)C)(O)O |
Computed by PubChem (NCBI)