Products 144909-21-7
CAS 144909-21-7 is the registry number for RG 14921. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-(2,5-dihydroxyphenyl)-1H-pyridin-2-one (CAS 144909-21-7) is a chemical compound with the molecular formula C11H9NO3 and a molecular weight of 203.19 g/mol. IUPAC name: 5-(2,5-dihydroxyphenyl)-1H-pyridin-2-one. InChIKey: BTJICUWFWQIODX-UHFFFAOYSA-N.
| Molecular formula | C11H9NO3 |
|---|---|
| Molecular weight | 203.19 g/mol |
| IUPAC name | 5-(2,5-dihydroxyphenyl)-1H-pyridin-2-one |
| InChIKey | BTJICUWFWQIODX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1O)C2=CNC(=O)C=C2)O |
Computed by PubChem (NCBI)