CAS 1449132-66-4 is the registry number for (3–(Cyclopentylcarbamoyl)–4–fluorophenyl)boronic acid. Offered by: GLPBio. Available pack sizes: 500mg.
[3-(cyclopentylcarbamoyl)-4-fluorophenyl]boronic acid (CAS 1449132-66-4) is a chemical compound with the molecular formula C12H15BFNO3 and a molecular weight of 251.06 g/mol. IUPAC name: [3-(cyclopentylcarbamoyl)-4-fluorophenyl]boronic acid. InChIKey: LUGNKXXVPNKQTO-UHFFFAOYSA-N.
| Molecular formula | C12H15BFNO3 |
|---|---|
| Molecular weight | 251.06 g/mol |
| IUPAC name | [3-(cyclopentylcarbamoyl)-4-fluorophenyl]boronic acid |
| InChIKey | LUGNKXXVPNKQTO-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)F)C(=O)NC2CCCC2)(O)O |
Computed by PubChem (NCBI)