CAS 1704063-68-2 is the registry number for (3–Fluoro–5–((4–oxopiperidin–1–yl)methyl)phenyl)boronic acid. Offered by: GLPBio. Available pack sizes: 500mg.
[3-fluoro-5-[(4-oxopiperidin-1-yl)methyl]phenyl]boronic acid (CAS 1704063-68-2) is a chemical compound with the molecular formula C12H15BFNO3 and a molecular weight of 251.06 g/mol. IUPAC name: [3-fluoro-5-[(4-oxopiperidin-1-yl)methyl]phenyl]boronic acid. InChIKey: RUNDPPVZGVNLEA-UHFFFAOYSA-N.
| Molecular formula | C12H15BFNO3 |
|---|---|
| Molecular weight | 251.06 g/mol |
| IUPAC name | [3-fluoro-5-[(4-oxopiperidin-1-yl)methyl]phenyl]boronic acid |
| InChIKey | RUNDPPVZGVNLEA-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)F)CN2CCC(=O)CC2)(O)O |
Computed by PubChem (NCBI)