CAS 1704064-22-1 is the registry number for (2–Fluoro–4–((4–oxopiperidin–1–yl)methyl)phenyl)boronic acid. Offered by: GLPBio. Available pack sizes: 1g.
[2-fluoro-4-[(4-oxopiperidin-1-yl)methyl]phenyl]boronic acid (CAS 1704064-22-1) is a chemical compound with the molecular formula C12H15BFNO3 and a molecular weight of 251.06 g/mol. IUPAC name: [2-fluoro-4-[(4-oxopiperidin-1-yl)methyl]phenyl]boronic acid. InChIKey: RPTBNULUQIKHCW-UHFFFAOYSA-N.
| Molecular formula | C12H15BFNO3 |
|---|---|
| Molecular weight | 251.06 g/mol |
| IUPAC name | [2-fluoro-4-[(4-oxopiperidin-1-yl)methyl]phenyl]boronic acid |
| InChIKey | RPTBNULUQIKHCW-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)CN2CCC(=O)CC2)F)(O)O |
Computed by PubChem (NCBI)