Products 144977-90-2
CAS 144977-90-2 appears in our catalog under these names: Ketoprofen Impurity 39, Ketoprofen Impurity 18, 3-Hydroxy Ketoprofen, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10mg, 2,5mg, 25mg.
2-[3-(3-hydroxybenzoyl)phenyl]propanoic acid (CAS 144977-90-2) is a chemical compound with the molecular formula C16H14O4 and a molecular weight of 270.28 g/mol. IUPAC name: 2-[3-(3-hydroxybenzoyl)phenyl]propanoic acid. InChIKey: RHJXPGJIYUQAGM-UHFFFAOYSA-N.
| Molecular formula | C16H14O4 |
|---|---|
| Molecular weight | 270.28 g/mol |
| IUPAC name | 2-[3-(3-hydroxybenzoyl)phenyl]propanoic acid |
| InChIKey | RHJXPGJIYUQAGM-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=CC=C1)C(=O)C2=CC(=CC=C2)O)C(=O)O |
Computed by PubChem (NCBI)