Products 1451013-67-4
CAS 1451013-67-4 is the registry number for HOI-07. Offered by: MedChemExpress. Available pack sizes: Get quote.
(3E)-3-[(E)-4-(1,3-benzodioxol-5-yl)-2-oxobut-3-enylidene]-1H-indol-2-one (CAS 1451013-67-4) is a chemical compound with the molecular formula C19H13NO4 and a molecular weight of 319.3 g/mol. IUPAC name: (3E)-3-[(E)-4-(1,3-benzodioxol-5-yl)-2-oxobut-3-enylidene]-1H-indol-2-one. InChIKey: NNWGHQZOKPDPAG-AJGUQREPSA-N.
| Molecular formula | C19H13NO4 |
|---|---|
| Molecular weight | 319.3 g/mol |
| IUPAC name | (3E)-3-[(E)-4-(1,3-benzodioxol-5-yl)-2-oxobut-3-enylidene]-1H-indol-2-one |
| InChIKey | NNWGHQZOKPDPAG-AJGUQREPSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)/C=C/C(=O)/C=C/3\C4=CC=CC=C4NC3=O |
Computed by PubChem (NCBI)