Products 1451392-02-1
CAS 1451392-02-1 appears in our catalog under these names: 4-Fluoro-3-methoxy-5-methylphenylboronic acid, 95%, (4-Fluoro-3-methoxy-5-methylphenyl)boronic acid, ≥95%, ≥95%, 4-Fluoro-3-methoxy-5-methylphenylboronic acid. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 25g, 1g, 250mg.
(4-fluoro-3-methoxy-5-methylphenyl)boronic acid (CAS 1451392-02-1) is a chemical compound with the molecular formula C8H10BFO3 and a molecular weight of 183.97 g/mol. IUPAC name: (4-fluoro-3-methoxy-5-methylphenyl)boronic acid. InChIKey: LWURTOAWJZDLLJ-UHFFFAOYSA-N.
| Molecular formula | C8H10BFO3 |
|---|---|
| Molecular weight | 183.97 g/mol |
| IUPAC name | (4-fluoro-3-methoxy-5-methylphenyl)boronic acid |
| InChIKey | LWURTOAWJZDLLJ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)OC)F)C)(O)O |
Computed by PubChem (NCBI)