Products 2598909-65-8

CAS 2598909-65-8 is the registry number for (6-bromo-2-fluoro-3-(trifluoromethyl)phenyl)boronic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

[6-bromo-2-fluoro-3-(trifluoromethyl)phenyl]boronic acid (CAS 2598909-65-8) is a chemical compound with the molecular formula C7H4BBrF4O2 and a molecular weight of 286.82 g/mol. IUPAC name: [6-bromo-2-fluoro-3-(trifluoromethyl)phenyl]boronic acid. InChIKey: PALHDFWMQLVJQM-UHFFFAOYSA-N.

Identity
Molecular formulaC7H4BBrF4O2
Molecular weight286.82 g/mol
IUPAC name[6-bromo-2-fluoro-3-(trifluoromethyl)phenyl]boronic acid
InChIKeyPALHDFWMQLVJQM-UHFFFAOYSA-N
SMILESB(C1=C(C=CC(=C1F)C(F)(F)F)Br)(O)O

Computed by PubChem (NCBI)