CAS 2598909-65-8 is the registry number for (6-bromo-2-fluoro-3-(trifluoromethyl)phenyl)boronic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
[6-bromo-2-fluoro-3-(trifluoromethyl)phenyl]boronic acid (CAS 2598909-65-8) is a chemical compound with the molecular formula C7H4BBrF4O2 and a molecular weight of 286.82 g/mol. IUPAC name: [6-bromo-2-fluoro-3-(trifluoromethyl)phenyl]boronic acid. InChIKey: PALHDFWMQLVJQM-UHFFFAOYSA-N.
| Molecular formula | C7H4BBrF4O2 |
|---|---|
| Molecular weight | 286.82 g/mol |
| IUPAC name | [6-bromo-2-fluoro-3-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | PALHDFWMQLVJQM-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1F)C(F)(F)F)Br)(O)O |
Computed by PubChem (NCBI)