CAS 1451408-62-0 is the registry number for Methyl (S)-chromane-2-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (2S)-3,4-dihydro-2H-chromene-2-carboxylate (CAS 1451408-62-0) is a chemical compound with the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. IUPAC name: methyl (2S)-3,4-dihydro-2H-chromene-2-carboxylate. InChIKey: CLPFQFDVPGZONF-JTQLQIEISA-N.
| Molecular formula | C11H12O3 |
|---|---|
| Molecular weight | 192.21 g/mol |
| IUPAC name | methyl (2S)-3,4-dihydro-2H-chromene-2-carboxylate |
| InChIKey | CLPFQFDVPGZONF-JTQLQIEISA-N |
| SMILES | COC(=O)[C@@H]1CCC2=CC=CC=C2O1 |
Computed by PubChem (NCBI)