CAS 145162-69-2 is the registry number for 1-Benzyl-5-nitro-1h-pyrazole, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-benzyl-5-nitropyrazole (CAS 145162-69-2) is a chemical compound with the molecular formula C10H9N3O2 and a molecular weight of 203.20 g/mol. IUPAC name: 1-benzyl-5-nitropyrazole. InChIKey: RJFGWYJJOPSQAF-UHFFFAOYSA-N.
| Molecular formula | C10H9N3O2 |
|---|---|
| Molecular weight | 203.20 g/mol |
| IUPAC name | 1-benzyl-5-nitropyrazole |
| InChIKey | RJFGWYJJOPSQAF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C(=CC=N2)[N+](=O)[O-] |
Computed by PubChem (NCBI)