Products 145261-31-0
CAS 145261-31-0 is the registry number for ORG-20241. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-(3,4-dimethoxyphenyl)-N'-hydroxy-1,3-thiazole-2-carboximidamide (CAS 145261-31-0) is a chemical compound with the molecular formula C12H13N3O3S and a molecular weight of 279.32 g/mol. IUPAC name: 4-(3,4-dimethoxyphenyl)-N'-hydroxy-1,3-thiazole-2-carboximidamide. InChIKey: MIXLZCYFMQNQDD-UHFFFAOYSA-N.
| Molecular formula | C12H13N3O3S |
|---|---|
| Molecular weight | 279.32 g/mol |
| IUPAC name | 4-(3,4-dimethoxyphenyl)-N'-hydroxy-1,3-thiazole-2-carboximidamide |
| InChIKey | MIXLZCYFMQNQDD-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=CSC(=N2)/C(=N/O)/N)OC |
Computed by PubChem (NCBI)