CAS 145438-94-4 appears in our catalog under these names: Perindopril Impurity 36, (2S,3aR,7aS)-Octahydroindole-2-carboxylic Acid (~90%, contains cis), (2S,3aR,7aS)-Octahydroindole-2-carboxylic acid, 97%. Offered by: Chemat Brand, TRC, AmBeed. Available pack sizes: on request, 100mg, 50mg, 250mg, 1g.
(2S,3aR,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxylic acid (CAS 145438-94-4) is a chemical compound with the molecular formula C9H15NO2 and a molecular weight of 169.22 g/mol. IUPAC name: (2S,3aR,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxylic acid. InChIKey: CQYBNXGHMBNGCG-CSMHCCOUSA-N.
| Molecular formula | C9H15NO2 |
|---|---|
| Molecular weight | 169.22 g/mol |
| IUPAC name | (2S,3aR,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxylic acid |
| InChIKey | CQYBNXGHMBNGCG-CSMHCCOUSA-N |
| SMILES | C1CC[C@H]2[C@H](C1)C[C@H](N2)C(=O)O |
Computed by PubChem (NCBI)