Products 145513-90-2

CAS 145513-90-2 is the registry number for Perindopril Impurity 52. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(2S,3aR,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxylic acid (CAS 145513-90-2) is a chemical compound with the molecular formula C9H15NO2 and a molecular weight of 169.22 g/mol. IUPAC name: (2S,3aR,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxylic acid. InChIKey: CQYBNXGHMBNGCG-PRJMDXOYSA-N.

Identity
Molecular formulaC9H15NO2
Molecular weight169.22 g/mol
IUPAC name(2S,3aR,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxylic acid
InChIKeyCQYBNXGHMBNGCG-PRJMDXOYSA-N
SMILESC1CC[C@@H]2[C@H](C1)C[C@H](N2)C(=O)O

Computed by PubChem (NCBI)