CAS 145513-90-2 is the registry number for Perindopril Impurity 52. Offered by: Chemat Brand. Available pack sizes: on request.
(2S,3aR,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxylic acid (CAS 145513-90-2) is a chemical compound with the molecular formula C9H15NO2 and a molecular weight of 169.22 g/mol. IUPAC name: (2S,3aR,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxylic acid. InChIKey: CQYBNXGHMBNGCG-PRJMDXOYSA-N.
| Molecular formula | C9H15NO2 |
|---|---|
| Molecular weight | 169.22 g/mol |
| IUPAC name | (2S,3aR,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxylic acid |
| InChIKey | CQYBNXGHMBNGCG-PRJMDXOYSA-N |
| SMILES | C1CC[C@@H]2[C@H](C1)C[C@H](N2)C(=O)O |
Computed by PubChem (NCBI)