CAS 87679-58-1 appears in our catalog under these names: (2S,3Ar,7as)-rel-octahydro-1h-indole-2-carboxylic acid, 95%, rel-(2S,3aR,7aS)-Octahydroindole-2-carboxylic Acid. Offered by: Combi-blocks, TRC. Available pack sizes: 250mg, 1g, 25mg, 50mg, 5mg.
(2S,3aR,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxylic acid (CAS 87679-58-1) is a chemical compound with the molecular formula C9H15NO2 and a molecular weight of 169.22 g/mol. IUPAC name: (2S,3aR,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxylic acid. InChIKey: CQYBNXGHMBNGCG-CSMHCCOUSA-N.
| Molecular formula | C9H15NO2 |
|---|---|
| Molecular weight | 169.22 g/mol |
| IUPAC name | (2S,3aR,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxylic acid |
| InChIKey | CQYBNXGHMBNGCG-CSMHCCOUSA-N |
| SMILES | C1CC[C@H]2[C@H](C1)C[C@H](N2)C(=O)O |
Computed by PubChem (NCBI)