CAS 145438-95-5 is the registry number for (2R,3aR,7aS)-Octahydro-1H-indole-2-carboxylic Acid. Offered by: TRC. Available pack sizes: 500mg.
(2R,3aR,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxylic acid (CAS 145438-95-5) is a chemical compound with the molecular formula C9H15NO2 and a molecular weight of 169.22 g/mol. IUPAC name: (2R,3aR,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxylic acid. InChIKey: CQYBNXGHMBNGCG-GJMOJQLCSA-N.
| Molecular formula | C9H15NO2 |
|---|---|
| Molecular weight | 169.22 g/mol |
| IUPAC name | (2R,3aR,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxylic acid |
| InChIKey | CQYBNXGHMBNGCG-GJMOJQLCSA-N |
| SMILES | C1CC[C@H]2[C@H](C1)C[C@@H](N2)C(=O)O |
Computed by PubChem (NCBI)