Products 14548-21-1

CAS 14548-21-1 is the registry number for (+)-Carnitine Benzyl Ester Chloride(>85%). Offered by: TRC. Available pack sizes: 10g, 2,5g, 500mg.

Structural formula: {0} (CAS {1})

[(2R)-2-hydroxy-4-oxo-4-phenylmethoxybutyl]-trimethylazanium chloride (CAS 14548-21-1) is a chemical compound with the molecular formula C14H22ClNO3 and a molecular weight of 287.78 g/mol. IUPAC name: [(2R)-2-hydroxy-4-oxo-4-phenylmethoxybutyl]-trimethylazanium chloride. InChIKey: YVRQGGDOPWFPBS-BTQNPOSSSA-M.

Identity
Molecular formulaC14H22ClNO3
Molecular weight287.78 g/mol
IUPAC name[(2R)-2-hydroxy-4-oxo-4-phenylmethoxybutyl]-trimethylazanium chloride
InChIKeyYVRQGGDOPWFPBS-BTQNPOSSSA-M
SMILESC[N+](C)(C)C[C@@H](CC(=O)OCC1=CC=CC=C1)O.[Cl-]

Computed by PubChem (NCBI)