CAS 14548-21-1 is the registry number for (+)-Carnitine Benzyl Ester Chloride(>85%). Offered by: TRC. Available pack sizes: 10g, 2,5g, 500mg.
[(2R)-2-hydroxy-4-oxo-4-phenylmethoxybutyl]-trimethylazanium chloride (CAS 14548-21-1) is a chemical compound with the molecular formula C14H22ClNO3 and a molecular weight of 287.78 g/mol. IUPAC name: [(2R)-2-hydroxy-4-oxo-4-phenylmethoxybutyl]-trimethylazanium chloride. InChIKey: YVRQGGDOPWFPBS-BTQNPOSSSA-M.
| Molecular formula | C14H22ClNO3 |
|---|---|
| Molecular weight | 287.78 g/mol |
| IUPAC name | [(2R)-2-hydroxy-4-oxo-4-phenylmethoxybutyl]-trimethylazanium chloride |
| InChIKey | YVRQGGDOPWFPBS-BTQNPOSSSA-M |
| SMILES | C[N+](C)(C)C[C@@H](CC(=O)OCC1=CC=CC=C1)O.[Cl-] |
Computed by PubChem (NCBI)