CAS 51482-39-4 appears in our catalog under these names: H–Tyr(tBu)–OMe·HCl, H-L-Tyr(tBu)-OMe*HCl, H-Tyr(tBu)-OMe.HCl, 95%, 95%, H-Tyr(tBu)-Ome HCl, 95%. Offered by: GLPBio, Iris Biotech, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 5g, 250mg, 1g, 10g.
Methyl (2S)-2-amino-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoate;hydrochloride (CAS 51482-39-4) is a chemical compound with the molecular formula C14H22ClNO3 and a molecular weight of 287.78 g/mol. IUPAC name: methyl (2S)-2-amino-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoate;hydrochloride. InChIKey: PAFVAMWJVIIMQK-YDALLXLXSA-N.
| Molecular formula | C14H22ClNO3 |
|---|---|
| Molecular weight | 287.78 g/mol |
| IUPAC name | methyl (2S)-2-amino-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoate;hydrochloride |
| InChIKey | PAFVAMWJVIIMQK-YDALLXLXSA-N |
| SMILES | CC(C)(C)OC1=CC=C(C=C1)C[C@@H](C(=O)OC)N.Cl |
Computed by PubChem (NCBI)