CAS 1998701-25-9 appears in our catalog under these names: (R)-Benzyl 2-amino-3-(tert-butoxy)propanoate hydrochloride, 95%, (R)–Benzyl 2–amino–3–(tert–butoxy)propanoate hydrochloride, H-D-Ser(tBu)-OBzl.HCl 98%, (R)-Benzyl 2-amino-3-(tert-butoxy)propanoate hydrochloride, 97%, 97%, (R)-Benzyl 2-amino-3-(tert-butoxy)propanoate hydrochloride, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg, 25g, 100g, 100mg.
Benzyl (2R)-2-amino-3-[(2-methylpropan-2-yl)oxy]propanoate;hydrochloride (CAS 1998701-25-9) is a chemical compound with the molecular formula C14H22ClNO3 and a molecular weight of 287.78 g/mol. IUPAC name: benzyl (2R)-2-amino-3-[(2-methylpropan-2-yl)oxy]propanoate;hydrochloride. InChIKey: HOYYQVAARUYRFU-UTONKHPSSA-N.
| Molecular formula | C14H22ClNO3 |
|---|---|
| Molecular weight | 287.78 g/mol |
| IUPAC name | benzyl (2R)-2-amino-3-[(2-methylpropan-2-yl)oxy]propanoate;hydrochloride |
| InChIKey | HOYYQVAARUYRFU-UTONKHPSSA-N |
| SMILES | CC(C)(C)OC[C@H](C(=O)OCC1=CC=CC=C1)N.Cl |
Computed by PubChem (NCBI)