Products 945419-73-8

CAS 945419-73-8 is the registry number for Ethyl 3-amino-3-(4-isopropoxyphenyl)propanoate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

Ethyl 3-amino-3-(4-propan-2-yloxyphenyl)propanoate;hydrochloride (CAS 945419-73-8) is a chemical compound with the molecular formula C14H22ClNO3 and a molecular weight of 287.78 g/mol. IUPAC name: ethyl 3-amino-3-(4-propan-2-yloxyphenyl)propanoate;hydrochloride. InChIKey: RDNYHWFOGWMIIW-UHFFFAOYSA-N.

Identity
Molecular formulaC14H22ClNO3
Molecular weight287.78 g/mol
IUPAC nameethyl 3-amino-3-(4-propan-2-yloxyphenyl)propanoate;hydrochloride
InChIKeyRDNYHWFOGWMIIW-UHFFFAOYSA-N
SMILESCCOC(=O)CC(C1=CC=C(C=C1)OC(C)C)N.Cl

Computed by PubChem (NCBI)