CAS 2174001-92-2 appears in our catalog under these names: Venlafaxine Impurity 2（Venlafaxine EP Impurity B）, Ethyl 3-(dimethylamino)-2-(4-methoxyphenyl)propanoate hydrochloride, 98%, Venlafaxine EP Impurity B (as Hydrochloride). Offered by: Hubei YoungXin, Chemat Brand, Mikromol. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, on request.
Ethyl 3-(dimethylamino)-2-(4-methoxyphenyl)propanoate;hydrochloride (CAS 2174001-92-2) is a chemical compound with the molecular formula C14H22ClNO3 and a molecular weight of 287.78 g/mol. IUPAC name: ethyl 3-(dimethylamino)-2-(4-methoxyphenyl)propanoate;hydrochloride. InChIKey: IGFQCXWQJNFNQZ-UHFFFAOYSA-N.
| Molecular formula | C14H22ClNO3 |
|---|---|
| Molecular weight | 287.78 g/mol |
| IUPAC name | ethyl 3-(dimethylamino)-2-(4-methoxyphenyl)propanoate;hydrochloride |
| InChIKey | IGFQCXWQJNFNQZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(CN(C)C)C1=CC=C(C=C1)OC.Cl |
Computed by PubChem (NCBI)