CAS 145513-91-3 appears in our catalog under these names: (2R,3aS,7aS)–Octahydro–1H–indole–2–carboxylic acid, H-D-Oic-OH 97%, (2R,3aS,7aS)-Octahydro-1H-indole-2-carboxylic acid, 97%, 97%, (2R,3aS,7aS)-Octahydro-1H-indole-2-carboxylic acid, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g, 500mg.
(2R,3aS,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxylic acid (CAS 145513-91-3) is a chemical compound with the molecular formula C9H15NO2 and a molecular weight of 169.22 g/mol. IUPAC name: (2R,3aS,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxylic acid. InChIKey: CQYBNXGHMBNGCG-BIIVOSGPSA-N.
| Molecular formula | C9H15NO2 |
|---|---|
| Molecular weight | 169.22 g/mol |
| IUPAC name | (2R,3aS,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxylic acid |
| InChIKey | CQYBNXGHMBNGCG-BIIVOSGPSA-N |
| SMILES | C1CC[C@H]2[C@@H](C1)C[C@@H](N2)C(=O)O |
Computed by PubChem (NCBI)