CAS 939045-17-7 is the registry number for Ethyl 6-bromo-1H-indole-2-carboxylate, N-BOC protected. Offered by: Biosynth. Available pack sizes: 5000mg, 1000mg.
1-O-tert-butyl 2-O-ethyl 6-bromoindole-1,2-dicarboxylate (CAS 939045-17-7) is a chemical compound with the molecular formula C16H18BrNO4 and a molecular weight of 368.22 g/mol. IUPAC name: 1-O-tert-butyl 2-O-ethyl 6-bromoindole-1,2-dicarboxylate. InChIKey: QXTZSJPXLCWTGK-UHFFFAOYSA-N.
| Molecular formula | C16H18BrNO4 |
|---|---|
| Molecular weight | 368.22 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-ethyl 6-bromoindole-1,2-dicarboxylate |
| InChIKey | QXTZSJPXLCWTGK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(N1C(=O)OC(C)(C)C)C=C(C=C2)Br |
Computed by PubChem (NCBI)