CAS 2173637-19-7 appears in our catalog under these names: (3R)-1,3-Dimethylpiperazine oxalic acid, 95%, (R)-1,3-Dimethylpiperazine oxalate, 97%, (3R)-1,3-dimethylpiperazine,oxalic acid, 97%, 97%, (3R)-1,3-DIMETHYLPIPERAZINE, OXALIC ACID, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 10g, 5g, 1g, 100mg, 500mg.
(3R)-1,3-dimethylpiperazine;oxalic acid (CAS 2173637-19-7) is a chemical compound with the molecular formula C8H16N2O4 and a molecular weight of 204.22 g/mol. IUPAC name: (3R)-1,3-dimethylpiperazine;oxalic acid. InChIKey: SVXAJXWNTKBQAH-FYZOBXCZSA-N.
| Molecular formula | C8H16N2O4 |
|---|---|
| Molecular weight | 204.22 g/mol |
| IUPAC name | (3R)-1,3-dimethylpiperazine;oxalic acid |
| InChIKey | SVXAJXWNTKBQAH-FYZOBXCZSA-N |
| SMILES | C[C@@H]1CN(CCN1)C.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)