CAS 14575-59-8 is the registry number for 1-Phenyl-1H-1,2,4-triazole-3,5-diamine. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
1-phenyl-1,2,4-triazole-3,5-diamine (CAS 14575-59-8) is a chemical compound with the molecular formula C8H9N5 and a molecular weight of 175.19 g/mol. IUPAC name: 1-phenyl-1,2,4-triazole-3,5-diamine. InChIKey: QCYJCZJMOAWVPC-UHFFFAOYSA-N.
| Molecular formula | C8H9N5 |
|---|---|
| Molecular weight | 175.19 g/mol |
| IUPAC name | 1-phenyl-1,2,4-triazole-3,5-diamine |
| InChIKey | QCYJCZJMOAWVPC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=NC(=N2)N)N |
Computed by PubChem (NCBI)