Products 1459253-81-6
CAS 1459253-81-6 is the registry number for 5-Bromo-4,7-difluoro-1H-indazole-3-carboxylic acid, 97%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
5-bromo-4,7-difluoro-2H-indazole-3-carboxylic acid (CAS 1459253-81-6) is a chemical compound with the molecular formula C8H3BrF2N2O2 and a molecular weight of 277.02 g/mol. IUPAC name: 5-bromo-4,7-difluoro-2H-indazole-3-carboxylic acid. InChIKey: CNTVZACLCZWECD-UHFFFAOYSA-N.
| Molecular formula | C8H3BrF2N2O2 |
|---|---|
| Molecular weight | 277.02 g/mol |
| IUPAC name | 5-bromo-4,7-difluoro-2H-indazole-3-carboxylic acid |
| InChIKey | CNTVZACLCZWECD-UHFFFAOYSA-N |
| SMILES | C1=C(C2=NNC(=C2C(=C1Br)F)C(=O)O)F |
Computed by PubChem (NCBI)