CAS 188028-30-0 is the registry number for 11-Bromo-5,5-difluoro-4,6-dioxa-10,12-diazatricyclo[7.3.0.03,]dodeca-1,3(7),8,10-tetraene, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
6-bromo-2,2-difluoro-5H-[1,3]dioxolo[4,5-f]benzimidazole (CAS 188028-30-0) is a chemical compound with the molecular formula C8H3BrF2N2O2 and a molecular weight of 277.02 g/mol. IUPAC name: 6-bromo-2,2-difluoro-5H-[1,3]dioxolo[4,5-f]benzimidazole. InChIKey: RSYWNTCKIJEFOH-UHFFFAOYSA-N.
| Molecular formula | C8H3BrF2N2O2 |
|---|---|
| Molecular weight | 277.02 g/mol |
| IUPAC name | 6-bromo-2,2-difluoro-5H-[1,3]dioxolo[4,5-f]benzimidazole |
| InChIKey | RSYWNTCKIJEFOH-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC3=C1OC(O3)(F)F)N=C(N2)Br |
Computed by PubChem (NCBI)