Products 2923867-69-8

CAS 2923867-69-8 is the registry number for 4-Bromo-3,5-difluoro-1H-indazole-7-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-bromo-3,5-difluoro-2H-indazole-7-carboxylic acid (CAS 2923867-69-8) is a chemical compound with the molecular formula C8H3BrF2N2O2 and a molecular weight of 277.02 g/mol. IUPAC name: 4-bromo-3,5-difluoro-2H-indazole-7-carboxylic acid. InChIKey: ZJMNVARFGCJPNG-UHFFFAOYSA-N.

Identity
Molecular formulaC8H3BrF2N2O2
Molecular weight277.02 g/mol
IUPAC name4-bromo-3,5-difluoro-2H-indazole-7-carboxylic acid
InChIKeyZJMNVARFGCJPNG-UHFFFAOYSA-N
SMILESC1=C(C2=NNC(=C2C(=C1F)Br)F)C(=O)O

Computed by PubChem (NCBI)