CAS 2766628-96-8 is the registry number for 7-Bromo-5,8-difluoroquinazoline-2,4(1H,3H)-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-bromo-5,8-difluoro-1H-quinazoline-2,4-dione (CAS 2766628-96-8) is a chemical compound with the molecular formula C8H3BrF2N2O2 and a molecular weight of 277.02 g/mol. IUPAC name: 7-bromo-5,8-difluoro-1H-quinazoline-2,4-dione. InChIKey: NYEDTNKBXTXJFB-UHFFFAOYSA-N.
| Molecular formula | C8H3BrF2N2O2 |
|---|---|
| Molecular weight | 277.02 g/mol |
| IUPAC name | 7-bromo-5,8-difluoro-1H-quinazoline-2,4-dione |
| InChIKey | NYEDTNKBXTXJFB-UHFFFAOYSA-N |
| SMILES | C1=C(C2=C(C(=C1Br)F)NC(=O)NC2=O)F |
Computed by PubChem (NCBI)