CAS 2692637-86-6 is the registry number for 6-Bromo-2-(difluoromethyl)-4H-pyrido[3,2-d][1,3]oxazin-4-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-bromo-2-(difluoromethyl)pyrido[3,2-d][1,3]oxazin-4-one (CAS 2692637-86-6) is a chemical compound with the molecular formula C8H3BrF2N2O2 and a molecular weight of 277.02 g/mol. IUPAC name: 6-bromo-2-(difluoromethyl)pyrido[3,2-d][1,3]oxazin-4-one. InChIKey: KWMQXIZGCYXROS-UHFFFAOYSA-N.
| Molecular formula | C8H3BrF2N2O2 |
|---|---|
| Molecular weight | 277.02 g/mol |
| IUPAC name | 6-bromo-2-(difluoromethyl)pyrido[3,2-d][1,3]oxazin-4-one |
| InChIKey | KWMQXIZGCYXROS-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=C1N=C(OC2=O)C(F)F)Br |
Computed by PubChem (NCBI)