CAS 1461706-28-4 is the registry number for (2,5-Dichlorophenyl)(phenyl)methanamine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(2,5-dichlorophenyl)-phenylmethanamine;hydrochloride (CAS 1461706-28-4) is a chemical compound with the molecular formula C13H12Cl3N and a molecular weight of 288.6 g/mol. IUPAC name: (2,5-dichlorophenyl)-phenylmethanamine;hydrochloride. InChIKey: SWYKBWOLCSNAIL-UHFFFAOYSA-N.
| Molecular formula | C13H12Cl3N |
|---|---|
| Molecular weight | 288.6 g/mol |
| IUPAC name | (2,5-dichlorophenyl)-phenylmethanamine;hydrochloride |
| InChIKey | SWYKBWOLCSNAIL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=C(C=CC(=C2)Cl)Cl)N.Cl |
Computed by PubChem (NCBI)