CAS 2138119-00-1 is the registry number for (3,5-Dichlorophenyl)(phenyl)methanamine hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
(3,5-dichlorophenyl)-phenylmethanamine;hydrochloride (CAS 2138119-00-1) is a chemical compound with the molecular formula C13H12Cl3N and a molecular weight of 288.6 g/mol. IUPAC name: (3,5-dichlorophenyl)-phenylmethanamine;hydrochloride. InChIKey: HORMJHUIOKZLAT-UHFFFAOYSA-N.
| Molecular formula | C13H12Cl3N |
|---|---|
| Molecular weight | 288.6 g/mol |
| IUPAC name | (3,5-dichlorophenyl)-phenylmethanamine;hydrochloride |
| InChIKey | HORMJHUIOKZLAT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC(=CC(=C2)Cl)Cl)N.Cl |
Computed by PubChem (NCBI)