Products 1461707-29-8

CAS 1461707-29-8 is the registry number for N-Boc Ketamine, 90.0%. Offered by: MedChemExpress. Available pack sizes: 1 mg, 5 mg.

Structural formula: {0} (CAS {1})

Tert-butyl N-[1-(2-chlorophenyl)-2-oxocyclohexyl]-N-methylcarbamate (CAS 1461707-29-8) is a chemical compound with the molecular formula C18H24ClNO3 and a molecular weight of 337.8 g/mol. IUPAC name: tert-butyl N-[1-(2-chlorophenyl)-2-oxocyclohexyl]-N-methylcarbamate. InChIKey: XWFIPKJXHXVWDZ-UHFFFAOYSA-N.

Identity
Molecular formulaC18H24ClNO3
Molecular weight337.8 g/mol
IUPAC nametert-butyl N-[1-(2-chlorophenyl)-2-oxocyclohexyl]-N-methylcarbamate
InChIKeyXWFIPKJXHXVWDZ-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N(C)C1(CCCCC1=O)C2=CC=CC=C2Cl

Computed by PubChem (NCBI)