Products 1461708-89-3
CAS 1461708-89-3 is the registry number for 7-Chloro-3-methyl-2,3,4,5-tetrahydro-1,5-benzothiazepin-4-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
7-chloro-3-methyl-3,5-dihydro-2H-1,5-benzothiazepin-4-one (CAS 1461708-89-3) is a chemical compound with the molecular formula C10H10ClNOS and a molecular weight of 227.71 g/mol. IUPAC name: 7-chloro-3-methyl-3,5-dihydro-2H-1,5-benzothiazepin-4-one. InChIKey: YXFZBULBIHBDBE-UHFFFAOYSA-N.
| Molecular formula | C10H10ClNOS |
|---|---|
| Molecular weight | 227.71 g/mol |
| IUPAC name | 7-chloro-3-methyl-3,5-dihydro-2H-1,5-benzothiazepin-4-one |
| InChIKey | YXFZBULBIHBDBE-UHFFFAOYSA-N |
| SMILES | CC1CSC2=C(C=C(C=C2)Cl)NC1=O |
Computed by PubChem (NCBI)