Products 401567-29-1
CAS 401567-29-1 appears in our catalog under these names: 2-Chloro-6-(propan-2-yloxy)-1,3-benzothiazole, 2-CHLORO-6-(PROPAN-2-YLOXY)-1,3-BENZOTHIAZOLE, 97%, 97%, 2-Chloro-6-isopropoxybenzo[d]thiazole, 97%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.
2-chloro-6-propan-2-yloxy-1,3-benzothiazole (CAS 401567-29-1) is a chemical compound with the molecular formula C10H10ClNOS and a molecular weight of 227.71 g/mol. IUPAC name: 2-chloro-6-propan-2-yloxy-1,3-benzothiazole. InChIKey: VDXJKIZWLVTCGY-UHFFFAOYSA-N.
| Molecular formula | C10H10ClNOS |
|---|---|
| Molecular weight | 227.71 g/mol |
| IUPAC name | 2-chloro-6-propan-2-yloxy-1,3-benzothiazole |
| InChIKey | VDXJKIZWLVTCGY-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=CC2=C(C=C1)N=C(S2)Cl |
Computed by PubChem (NCBI)