CAS 1461709-33-0 appears in our catalog under these names: 4-((3-Methyl-1,2,4-oxadiazol-5-yl)methyl)aniline hydrochloride, 95%, 4-((3-Methyl-1,2,4-oxadiazol-5-yl)methyl)aniline hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]aniline;hydrochloride (CAS 1461709-33-0) is a chemical compound with the molecular formula C10H12ClN3O and a molecular weight of 225.67 g/mol. IUPAC name: 4-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]aniline;hydrochloride. InChIKey: FQXFUNGGYGTBQW-UHFFFAOYSA-N.
| Molecular formula | C10H12ClN3O |
|---|---|
| Molecular weight | 225.67 g/mol |
| IUPAC name | 4-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]aniline;hydrochloride |
| InChIKey | FQXFUNGGYGTBQW-UHFFFAOYSA-N |
| SMILES | CC1=NOC(=N1)CC2=CC=C(C=C2)N.Cl |
Computed by PubChem (NCBI)