CAS 146196-91-0 appears in our catalog under these names: Flavanone-d5, >95% (HPLC), Flavanone-d5. Offered by: TRC, Biosynth. Available pack sizes: 2,5mg, 25mg, 50mg.
2-(2,3,4,5,6-pentadeuteriophenyl)-2,3-dihydrochromen-4-one (CAS 146196-91-0) is a chemical compound with the molecular formula C15H12O2 and a molecular weight of 229.28 g/mol. IUPAC name: 2-(2,3,4,5,6-pentadeuteriophenyl)-2,3-dihydrochromen-4-one. InChIKey: ZONYXWQDUYMKFB-FSTBWYLISA-N.
| Molecular formula | C15H12O2 |
|---|---|
| Molecular weight | 229.28 g/mol |
| IUPAC name | 2-(2,3,4,5,6-pentadeuteriophenyl)-2,3-dihydrochromen-4-one |
| InChIKey | ZONYXWQDUYMKFB-FSTBWYLISA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C2CC(=O)C3=CC=CC=C3O2)[2H])[2H] |
Computed by PubChem (NCBI)