Products 91-48-5
CAS 91-48-5 appears in our catalog under these names: Alpha-phenylcinnamic acid, 95%, alpha-Phenylcinnamic Acid, α–Phenylcinnamic Acid, alpha-Phenylcinnamic Acid, >98.0%(T), (E)-2,3-Diphenylacrylic acid 95%. Offered by: Combi-blocks, Chemat Brand, GLPBio, TCI, Ambeed. Available pack sizes: 5g, 25g, 1g, on request, 10g, 100g.
(E)-2,3-diphenylprop-2-enoic acid (CAS 91-48-5) is a chemical compound with the molecular formula C15H12O2 and a molecular weight of 224.25 g/mol. IUPAC name: (E)-2,3-diphenylprop-2-enoic acid. InChIKey: BIDDLDNGQCUOJQ-SDNWHVSQSA-N.
| Molecular formula | C15H12O2 |
|---|---|
| Molecular weight | 224.25 g/mol |
| IUPAC name | (E)-2,3-diphenylprop-2-enoic acid |
| InChIKey | BIDDLDNGQCUOJQ-SDNWHVSQSA-N |
| SMILES | C1=CC=C(C=C1)/C=C(\C2=CC=CC=C2)/C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
alpha-Phenylcinnamic acid, (E)-2,3-Diphenylacrylic Acid, 2,3-diphenylacrylic acid, 2,3-diphenylprop-2-enoic acid, (E)-2,3-Diphenylpropenoic acid, (e)-alpha-phenylcinnamic acid, trans-alpha-Phenylcinnamic Acid, trans-2,3-Diphenylacrylic acid, alpha-Phenylcinnamic acid, (E)-, trans-2,3-Diphenylpropenoic acid