CAS 17910-73-5 appears in our catalog under these names: 2-Hydroxy-5-dibenzosuberone, 98%, 2-Hydroxy-5-dibenzosuberone 98%, 2–Hydroxy–10,11–dihydro–5H–dibenzo(A,D)(7)annulen–5–one, DCHD-Linker, 2-Hydroxy-10,11-dihydro-5H-dibenzo[A,D][7]annulen-5-one, 98%, 98%. Offered by: Combi-blocks, Ambeed, GLPBio, Iris Biotech, Chemat. Available pack sizes: 25g, 10g, 1g, 5g, 250mg, 100mg.
6-hydroxytricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaen-2-one (CAS 17910-73-5) is a chemical compound with the molecular formula C15H12O2 and a molecular weight of 224.25 g/mol. IUPAC name: 6-hydroxytricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaen-2-one. InChIKey: MSGQRAAQALHWFA-UHFFFAOYSA-N.
| Molecular formula | C15H12O2 |
|---|---|
| Molecular weight | 224.25 g/mol |
| IUPAC name | 6-hydroxytricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaen-2-one |
| InChIKey | MSGQRAAQALHWFA-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC(=C2)O)C(=O)C3=CC=CC=C31 |
Computed by PubChem (NCBI)