Products 1184947-02-1
CAS 1184947-02-1 appears in our catalog under these names: 6-Methyl-11h-dibenzo[b,f]oxepin-10-one, 95%, 6-Methyldibenzo(b,f)oxepin-10(11H)-one, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g.
1-methyl-6H-benzo[b][1]benzoxepin-5-one (CAS 1184947-02-1) is a chemical compound with the molecular formula C15H12O2 and a molecular weight of 224.25 g/mol. IUPAC name: 1-methyl-6H-benzo[b][1]benzoxepin-5-one. InChIKey: GKHIHRYGKFTENO-UHFFFAOYSA-N.
| Molecular formula | C15H12O2 |
|---|---|
| Molecular weight | 224.25 g/mol |
| IUPAC name | 1-methyl-6H-benzo[b][1]benzoxepin-5-one |
| InChIKey | GKHIHRYGKFTENO-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)C(=O)CC3=CC=CC=C3O2 |
Computed by PubChem (NCBI)