Products 146196-93-2
CAS 146196-93-2 is the registry number for (2E)-1-(2-Hydroxyphenyl)-3-(phenyl-d5)-2-propen-1-one. Offered by: TRC. Available pack sizes: 25mg.
(E)-1-(2-hydroxyphenyl)-3-(2,3,4,5,6-pentadeuteriophenyl)prop-2-en-1-one (CAS 146196-93-2) is a chemical compound with the molecular formula C15H12O2 and a molecular weight of 229.28 g/mol. IUPAC name: (E)-1-(2-hydroxyphenyl)-3-(2,3,4,5,6-pentadeuteriophenyl)prop-2-en-1-one. InChIKey: AETKQQBRKSELEL-CDTMZHDGSA-N.
| Molecular formula | C15H12O2 |
|---|---|
| Molecular weight | 229.28 g/mol |
| IUPAC name | (E)-1-(2-hydroxyphenyl)-3-(2,3,4,5,6-pentadeuteriophenyl)prop-2-en-1-one |
| InChIKey | AETKQQBRKSELEL-CDTMZHDGSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])/C=C/C(=O)C2=CC=CC=C2O)[2H])[2H] |
Computed by PubChem (NCBI)