CAS 146321-88-2 appears in our catalog under these names: 5-Acetyl-2,3-dihydrobenzofuran oxime, 95%, N-(1-(2,3-Dihydro-1-benzofuran-5-yl)ethylidene)hydroxylamine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 2,5g.
(NE)-N-[1-(2,3-dihydro-1-benzofuran-5-yl)ethylidene]hydroxylamine (CAS 146321-88-2) is a chemical compound with the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. IUPAC name: (NE)-N-[1-(2,3-dihydro-1-benzofuran-5-yl)ethylidene]hydroxylamine. InChIKey: RAEPYEDOZKENTI-YRNVUSSQSA-N.
| Molecular formula | C10H11NO2 |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | (NE)-N-[1-(2,3-dihydro-1-benzofuran-5-yl)ethylidene]hydroxylamine |
| InChIKey | RAEPYEDOZKENTI-YRNVUSSQSA-N |
| SMILES | C/C(=N\O)/C1=CC2=C(C=C1)OCC2 |
Computed by PubChem (NCBI)