CAS 146346-69-2 is the registry number for (S)-2,7-Diaminoheptanoic acid dihydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g, 250mg.
(2S)-2,7-diaminoheptanoic acid;dihydrochloride (CAS 146346-69-2) is a chemical compound with the molecular formula C7H18Cl2N2O2 and a molecular weight of 233.13 g/mol. IUPAC name: (2S)-2,7-diaminoheptanoic acid;dihydrochloride. InChIKey: DZTTYYXCJJCKTJ-ILKKLZGPSA-N.
| Molecular formula | C7H18Cl2N2O2 |
|---|---|
| Molecular weight | 233.13 g/mol |
| IUPAC name | (2S)-2,7-diaminoheptanoic acid;dihydrochloride |
| InChIKey | DZTTYYXCJJCKTJ-ILKKLZGPSA-N |
| SMILES | C(CC[C@@H](C(=O)O)N)CCN.Cl.Cl |
Computed by PubChem (NCBI)