Products 1956386-55-2

CAS 1956386-55-2 is the registry number for Methyl 4-amino-2-(2-aminoethyl)butanoate dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

Methyl 4-amino-2-(2-aminoethyl)butanoate;dihydrochloride (CAS 1956386-55-2) is a chemical compound with the molecular formula C7H18Cl2N2O2 and a molecular weight of 233.13 g/mol. IUPAC name: methyl 4-amino-2-(2-aminoethyl)butanoate;dihydrochloride. InChIKey: NMRRDLGOFZRYMX-UHFFFAOYSA-N.

Identity
Molecular formulaC7H18Cl2N2O2
Molecular weight233.13 g/mol
IUPAC namemethyl 4-amino-2-(2-aminoethyl)butanoate;dihydrochloride
InChIKeyNMRRDLGOFZRYMX-UHFFFAOYSA-N
SMILESCOC(=O)C(CCN)CCN.Cl.Cl

Computed by PubChem (NCBI)