CAS 26348-70-9 appears in our catalog under these names: L-Lysine Methyl Ester Dihydrochloride, H–Lys–OMe ·2HCl, H-Lys-OMe.2HCl, H-L-Lys-OMe*2HCl, L-Lysine methyl ester dihydrochloride, 99% . Offered by: TRC, GLPBio, TargetMol, Iris Biotech, Thermo Scientific (Alfa Aesar). Available pack sizes: 10g, 25g, 5g, 500mg, 250g, 1kg, 100g, 500g.
Methyl (2S)-2,6-diaminohexanoate;dihydrochloride (CAS 26348-70-9) is a chemical compound with the molecular formula C7H18Cl2N2O2 and a molecular weight of 233.13 g/mol. IUPAC name: methyl (2S)-2,6-diaminohexanoate;dihydrochloride. InChIKey: SXZCBVCQHOJXDR-ILKKLZGPSA-N.
| Molecular formula | C7H18Cl2N2O2 |
|---|---|
| Molecular weight | 233.13 g/mol |
| IUPAC name | methyl (2S)-2,6-diaminohexanoate;dihydrochloride |
| InChIKey | SXZCBVCQHOJXDR-ILKKLZGPSA-N |
| SMILES | COC(=O)[C@H](CCCCN)N.Cl.Cl |
Computed by PubChem (NCBI)