CAS 2377004-98-1 is the registry number for tert-Butyl (2S)-2,3-diaminopropanoate dihydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Tert-butyl (2S)-2,3-diaminopropanoate;dihydrochloride (CAS 2377004-98-1) is a chemical compound with the molecular formula C7H18Cl2N2O2 and a molecular weight of 233.13 g/mol. IUPAC name: tert-butyl (2S)-2,3-diaminopropanoate;dihydrochloride. InChIKey: SLJLNVREOWBRNO-XRIGFGBMSA-N.
| Molecular formula | C7H18Cl2N2O2 |
|---|---|
| Molecular weight | 233.13 g/mol |
| IUPAC name | tert-butyl (2S)-2,3-diaminopropanoate;dihydrochloride |
| InChIKey | SLJLNVREOWBRNO-XRIGFGBMSA-N |
| SMILES | CC(C)(C)OC(=O)[C@H](CN)N.Cl.Cl |
Computed by PubChem (NCBI)