CAS 1464986-88-6 is the registry number for Benzyl (1S,4S)-2,5-diazabicyclo(2.2.1)heptane-2-carboxylate, 98%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
Benzyl (1S,4S)-2,5-diazabicyclo[2.2.1]heptane-2-carboxylate (CAS 1464986-88-6) is a chemical compound with the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. IUPAC name: benzyl (1S,4S)-2,5-diazabicyclo[2.2.1]heptane-2-carboxylate. InChIKey: SFFOUMARWDXTDD-RYUDHWBXSA-N.
| Molecular formula | C13H16N2O2 |
|---|---|
| Molecular weight | 232.28 g/mol |
| IUPAC name | benzyl (1S,4S)-2,5-diazabicyclo[2.2.1]heptane-2-carboxylate |
| InChIKey | SFFOUMARWDXTDD-RYUDHWBXSA-N |
| SMILES | C1[C@H]2CN[C@@H]1CN2C(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)