CAS 146575-64-6 appears in our catalog under these names: 2'-Hydroxy-5'-(trifluoromethoxy)acetophenone, 95%, 1-(2-Hydroxy-5-(trifluoromethoxy)phenyl)ethan-1-one, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg, 10g.
1-[2-hydroxy-5-(trifluoromethoxy)phenyl]ethanone (CAS 146575-64-6) is a chemical compound with the molecular formula C9H7F3O3 and a molecular weight of 220.14 g/mol. IUPAC name: 1-[2-hydroxy-5-(trifluoromethoxy)phenyl]ethanone. InChIKey: FYWYHQOZXGAPSF-UHFFFAOYSA-N.
| Molecular formula | C9H7F3O3 |
|---|---|
| Molecular weight | 220.14 g/mol |
| IUPAC name | 1-[2-hydroxy-5-(trifluoromethoxy)phenyl]ethanone |
| InChIKey | FYWYHQOZXGAPSF-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=CC(=C1)OC(F)(F)F)O |
Computed by PubChem (NCBI)